C9H8BrClN4 — CID 107938618
5-(3-bromo-5-chlorophenyl)-2-methyl-1,2,4-triazol-3-amine (PubChem CID 107938618) has the molecular formula C9H8BrClN4 and a molecular weight of 287.55 g/mol. Its IUPAC name is 5-(3-bromo-5-chlorophenyl)-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(3-bromo-5-chlorophenyl)-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 107938618 |
| Molecular Formula | C9H8BrClN4 |
| Molecular Weight | 287.55 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 5-(3-bromo-5-chlorophenyl)-2-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(-c2cc(Cl)cc(Br)c2)nc1N |
| InChI | InChI=1S/C9H8BrClN4/c1-15-9(12)13-8(14-15)5-2-6(10)4-7(11)3-5/h2-4H,1H3,(H2,12,13,14) |
| InChIKey | LCYBFPMJYUWUSH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |