C8H9N5O — CID 104605415
5-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyridin-3-ol (PubChem CID 104605415) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyridin-3-ol.
| Compound Name | 5-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 104605415 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 5-(5-amino-1-methyl-1,2,4-triazol-3-yl)pyridin-3-ol |
| SMILES | Cn1nc(-c2cncc(O)c2)nc1N |
| InChI | InChI=1S/C8H9N5O/c1-13-8(9)11-7(12-13)5-2-6(14)4-10-3-5/h2-4,14H,1H3,(H2,9,11,12) |
| InChIKey | DAMXCYJRWSPNGE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |