About 5-aminopyridin-3-ol;hydrobromide
5-aminopyridin-3-ol;hydrobromide (PubChem CID 156594738) has the molecular formula C5H7BrN2O
and a molecular weight of 191.03 g/mol. Its IUPAC name is 5-aminopyridin-3-ol;hydrobromide.
Molecular Properties
| Compound Name | 5-aminopyridin-3-ol;hydrobromide |
| PubChem CID | 156594738 |
| Molecular Formula | C5H7BrN2O |
| Molecular Weight | 191.03 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | 5-aminopyridin-3-ol;hydrobromide |
| SMILES | Br.Nc1cncc(O)c1 |
| InChI | InChI=1S/C5H6N2O.BrH/c6-4-1-5(8)3-7-2-4;/h1-3,8H,6H2;1H |
| InChIKey | RWIXTCSKSXKIMV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.03 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-aminopyridin-3-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopyridin-3-ol;hydrobromide?
The IUPAC name of 5-aminopyridin-3-ol;hydrobromide (CID 156594738) is 5-aminopyridin-3-ol;hydrobromide.
What is the SMILES notation for 5-aminopyridin-3-ol;hydrobromide?
The canonical SMILES for 5-aminopyridin-3-ol;hydrobromide is Br.Nc1cncc(O)c1.
What is the InChIKey of 5-aminopyridin-3-ol;hydrobromide?
The InChIKey is RWIXTCSKSXKIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.BrH/c6-4-1-5(8)3-7-2-4;/h1-3,8H,6H2;1H.
What are the key properties of 5-aminopyridin-3-ol;hydrobromide?
5-aminopyridin-3-ol;hydrobromide has a molecular weight of 191.03 g/mol, XLogP of 0.95, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopyridin-3-ol;hydrobromide is sourced from PubChem (CID 156594738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).