About sodium;5-bromopyridin-3-amine;hydroxide
sodium;5-bromopyridin-3-amine;hydroxide (PubChem CID 142881303) has the molecular formula C5H6BrN2NaO
and a molecular weight of 213.01 g/mol. Its IUPAC name is sodium;5-bromopyridin-3-amine;hydroxide.
Molecular Properties
| Compound Name | sodium;5-bromopyridin-3-amine;hydroxide |
| PubChem CID | 142881303 |
| Molecular Formula | C5H6BrN2NaO |
| Molecular Weight | 213.01 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | sodium;5-bromopyridin-3-amine;hydroxide |
| SMILES | Nc1cncc(Br)c1.[Na+].[OH-] |
| InChI | InChI=1S/C5H5BrN2.Na.H2O/c6-4-1-5(7)3-8-2-4;;/h1-3H,7H2;;1H2/q;+1;/p-1 |
| InChIKey | BHXUEFMZGOZUSR-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 68.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.01 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;5-bromopyridin-3-amine;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-bromopyridin-3-amine;hydroxide?
The IUPAC name of sodium;5-bromopyridin-3-amine;hydroxide (CID 142881303) is sodium;5-bromopyridin-3-amine;hydroxide.
What is the SMILES notation for sodium;5-bromopyridin-3-amine;hydroxide?
The canonical SMILES for sodium;5-bromopyridin-3-amine;hydroxide is Nc1cncc(Br)c1.[Na+].[OH-].
What is the InChIKey of sodium;5-bromopyridin-3-amine;hydroxide?
The InChIKey is BHXUEFMZGOZUSR-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5BrN2.Na.H2O/c6-4-1-5(7)3-8-2-4;;/h1-3H,7H2;;1H2/q;+1;/p-1.
What are the key properties of sodium;5-bromopyridin-3-amine;hydroxide?
sodium;5-bromopyridin-3-amine;hydroxide has a molecular weight of 213.01 g/mol, XLogP of -1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-bromopyridin-3-amine;hydroxide is sourced from PubChem (CID 142881303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).