C6H8BrN3O — CID 175312718
5-bromopyridin-3-amine;formamide (PubChem CID 175312718) has the molecular formula C6H8BrN3O and a molecular weight of 218.05 g/mol. Its IUPAC name is 5-bromopyridin-3-amine;formamide.
| Compound Name | 5-bromopyridin-3-amine;formamide |
|---|---|
| PubChem CID | 175312718 |
| Molecular Formula | C6H8BrN3O |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 5-bromopyridin-3-amine;formamide |
| SMILES | NC=O.Nc1cncc(Br)c1 |
| InChI | InChI=1S/C5H5BrN2.CH3NO/c6-4-1-5(7)3-8-2-4;2-1-3/h1-3H,7H2;1H,(H2,2,3) |
| InChIKey | INLJMHBXBIRQIR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|