About potassium;5-bromopyridine-3-carbaldehyde;hydroxide
potassium;5-bromopyridine-3-carbaldehyde;hydroxide (PubChem CID 172681834) has the molecular formula C6H5BrKNO2
and a molecular weight of 242.11 g/mol. Its IUPAC name is potassium;5-bromopyridine-3-carbaldehyde;hydroxide.
Molecular Properties
| Compound Name | potassium;5-bromopyridine-3-carbaldehyde;hydroxide |
| PubChem CID | 172681834 |
| Molecular Formula | C6H5BrKNO2 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 240.91 |
| IUPAC Name | potassium;5-bromopyridine-3-carbaldehyde;hydroxide |
| SMILES | O=Cc1cncc(Br)c1.[K+].[OH-] |
| InChI | InChI=1S/C6H4BrNO.K.H2O/c7-6-1-5(4-9)2-8-3-6;;/h1-4H;;1H2/q;+1;/p-1 |
| InChIKey | AMWWWMGGRMCPLH-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 59.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze potassium;5-bromopyridine-3-carbaldehyde;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-bromopyridine-3-carbaldehyde;hydroxide?
The IUPAC name of potassium;5-bromopyridine-3-carbaldehyde;hydroxide (CID 172681834) is potassium;5-bromopyridine-3-carbaldehyde;hydroxide.
What is the SMILES notation for potassium;5-bromopyridine-3-carbaldehyde;hydroxide?
The canonical SMILES for potassium;5-bromopyridine-3-carbaldehyde;hydroxide is O=Cc1cncc(Br)c1.[K+].[OH-].
What is the InChIKey of potassium;5-bromopyridine-3-carbaldehyde;hydroxide?
The InChIKey is AMWWWMGGRMCPLH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4BrNO.K.H2O/c7-6-1-5(4-9)2-8-3-6;;/h1-4H;;1H2/q;+1;/p-1.
What are the key properties of potassium;5-bromopyridine-3-carbaldehyde;hydroxide?
potassium;5-bromopyridine-3-carbaldehyde;hydroxide has a molecular weight of 242.11 g/mol, XLogP of -1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-bromopyridine-3-carbaldehyde;hydroxide is sourced from PubChem (CID 172681834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).