C13H7BrF3N — CID 123543896
3-bromo-5-[2-(2,4,5-trifluorophenyl)ethenyl]pyridine (PubChem CID 123543896) has the molecular formula C13H7BrF3N and a molecular weight of 314.10 g/mol. Its IUPAC name is 3-bromo-5-[2-(2,4,5-trifluorophenyl)ethenyl]pyridine.
| Compound Name | 3-bromo-5-[2-(2,4,5-trifluorophenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 123543896 |
| Molecular Formula | C13H7BrF3N |
| Molecular Weight | 314.10 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 3-bromo-5-[2-(2,4,5-trifluorophenyl)ethenyl]pyridine |
| SMILES | Fc1cc(F)c(C=Cc2cncc(Br)c2)cc1F |
| InChI | InChI=1S/C13H7BrF3N/c14-10-3-8(6-18-7-10)1-2-9-4-12(16)13(17)5-11(9)15/h1-7H |
| InChIKey | FZHALEJWQMEFEX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.10 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|