About 5-aminopyridin-3-ol;methane
5-aminopyridin-3-ol;methane (PubChem CID 142968120) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-aminopyridin-3-ol;methane.
Molecular Properties
| Compound Name | 5-aminopyridin-3-ol;methane |
| PubChem CID | 142968120 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-aminopyridin-3-ol;methane |
| SMILES | C.Nc1cncc(O)c1 |
| InChI | InChI=1S/C5H6N2O.CH4/c6-4-1-5(8)3-7-2-4;/h1-3,8H,6H2;1H4 |
| InChIKey | RXANZOPFGALDHG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-aminopyridin-3-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopyridin-3-ol;methane?
The IUPAC name of 5-aminopyridin-3-ol;methane (CID 142968120) is 5-aminopyridin-3-ol;methane.
What is the SMILES notation for 5-aminopyridin-3-ol;methane?
The canonical SMILES for 5-aminopyridin-3-ol;methane is C.Nc1cncc(O)c1.
What is the InChIKey of 5-aminopyridin-3-ol;methane?
The InChIKey is RXANZOPFGALDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.CH4/c6-4-1-5(8)3-7-2-4;/h1-3,8H,6H2;1H4.
What are the key properties of 5-aminopyridin-3-ol;methane?
5-aminopyridin-3-ol;methane has a molecular weight of 126.16 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopyridin-3-ol;methane is sourced from PubChem (CID 142968120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).