C7H11N3O — CID 55273539
5-[(1S)-1,2-diaminoethyl]pyridin-3-ol (PubChem CID 55273539) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 5-[(1S)-1,2-diaminoethyl]pyridin-3-ol.
| Compound Name | 5-[(1S)-1,2-diaminoethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 55273539 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 5-[(1S)-1,2-diaminoethyl]pyridin-3-ol |
| SMILES | NC[C@@H](N)c1cncc(O)c1 |
| InChI | InChI=1S/C7H11N3O/c8-2-7(9)5-1-6(11)4-10-3-5/h1,3-4,7,11H,2,8-9H2/t7-/m1/s1 |
| InChIKey | RQCIVKDFQMJDRK-SSDOTTSWSA-N |
| XLogP | -0.25 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |