C7H13N5 — CID 130738641
5-[(1S)-1,2-diaminoethyl]pyridine-2,3-diamine (PubChem CID 130738641) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 5-[(1S)-1,2-diaminoethyl]pyridine-2,3-diamine.
| Compound Name | 5-[(1S)-1,2-diaminoethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 130738641 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 5-[(1S)-1,2-diaminoethyl]pyridine-2,3-diamine |
| SMILES | NC[C@@H](N)c1cnc(N)c(N)c1 |
| InChI | InChI=1S/C7H13N5/c8-2-6(10)4-1-5(9)7(11)12-3-4/h1,3,6H,2,8-10H2,(H2,11,12)/t6-/m1/s1 |
| InChIKey | SHSNLKTVPZVEAX-ZCFIWIBFSA-N |
| XLogP | -0.80 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |