C8H9IN4 — CID 131218152
(3S)-3-amino-3-(6-amino-5-iodo-3-pyridinyl)propanenitrile (PubChem CID 131218152) has the molecular formula C8H9IN4 and a molecular weight of 288.09 g/mol. Its IUPAC name is (3S)-3-amino-3-(6-amino-5-iodo-3-pyridinyl)propanenitrile.
| Compound Name | (3S)-3-amino-3-(6-amino-5-iodo-3-pyridinyl)propanenitrile |
|---|---|
| PubChem CID | 131218152 |
| Molecular Formula | C8H9IN4 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | (3S)-3-amino-3-(6-amino-5-iodo-3-pyridinyl)propanenitrile |
| SMILES | N#CC[C@H](N)c1cnc(N)c(I)c1 |
| InChI | InChI=1S/C8H9IN4/c9-6-3-5(4-13-8(6)12)7(11)1-2-10/h3-4,7H,1,11H2,(H2,12,13)/t7-/m0/s1 |
| InChIKey | SCIKTZHVNARDQN-ZETCQYMHSA-N |
| XLogP | 1.18 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|