C8H14N4O — CID 131010797
(1S,2S)-2-amino-1-(5,6-diamino-3-pyridinyl)propan-1-ol (PubChem CID 131010797) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-(5,6-diamino-3-pyridinyl)propan-1-ol.
| Compound Name | (1S,2S)-2-amino-1-(5,6-diamino-3-pyridinyl)propan-1-ol |
|---|---|
| PubChem CID | 131010797 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (1S,2S)-2-amino-1-(5,6-diamino-3-pyridinyl)propan-1-ol |
| SMILES | C[C@H](N)[C@@H](O)c1cnc(N)c(N)c1 |
| InChI | InChI=1S/C8H14N4O/c1-4(9)7(13)5-2-6(10)8(11)12-3-5/h2-4,7,13H,9-10H2,1H3,(H2,11,12)/t4-,7+/m0/s1 |
| InChIKey | MKGUNCYYTCXTMG-MHTLYPKNSA-N |
| XLogP | -0.37 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |