C8H12ClN3O — CID 130706086
(1S,2R)-1-amino-1-(5-amino-6-chloro-3-pyridinyl)propan-2-ol (PubChem CID 130706086) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(5-amino-6-chloro-3-pyridinyl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(5-amino-6-chloro-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 130706086 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (1S,2R)-1-amino-1-(5-amino-6-chloro-3-pyridinyl)propan-2-ol |
| SMILES | C[C@@H](O)[C@@H](N)c1cnc(Cl)c(N)c1 |
| InChI | InChI=1S/C8H12ClN3O/c1-4(13)7(11)5-2-6(10)8(9)12-3-5/h2-4,7,13H,10-11H2,1H3/t4-,7-/m1/s1 |
| InChIKey | OXUIZPUVCPUDSJ-CLZZGJSISA-N |
| XLogP | 0.70 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|