C9H12Cl2N2 — CID 130714020
(1S)-1-(5,6-dichloro-3-pyridinyl)-2-methylpropan-1-amine (PubChem CID 130714020) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.12 g/mol. Its IUPAC name is (1S)-1-(5,6-dichloro-3-pyridinyl)-2-methylpropan-1-amine.
| Compound Name | (1S)-1-(5,6-dichloro-3-pyridinyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 130714020 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (1S)-1-(5,6-dichloro-3-pyridinyl)-2-methylpropan-1-amine |
| SMILES | CC(C)[C@H](N)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2/c1-5(2)8(12)6-3-7(10)9(11)13-4-6/h3-5,8H,12H2,1-2H3/t8-/m0/s1 |
| InChIKey | ZGKZYXFTPHYOLF-QMMMGPOBSA-N |
| XLogP | 3.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|