C9H12F2N2 — CID 130623639
(1R)-1-(5,6-difluoro-3-pyridinyl)-2-methylpropan-1-amine (PubChem CID 130623639) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is (1R)-1-(5,6-difluoro-3-pyridinyl)-2-methylpropan-1-amine.
| Compound Name | (1R)-1-(5,6-difluoro-3-pyridinyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 130623639 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (1R)-1-(5,6-difluoro-3-pyridinyl)-2-methylpropan-1-amine |
| SMILES | CC(C)[C@@H](N)c1cnc(F)c(F)c1 |
| InChI | InChI=1S/C9H12F2N2/c1-5(2)8(12)6-3-7(10)9(11)13-4-6/h3-5,8H,12H2,1-2H3/t8-/m1/s1 |
| InChIKey | LCPPBCYMEFMREY-MRVPVSSYSA-N |
| XLogP | 2.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|