C8H11ClN2O — CID 55270497
(1R,2R)-1-amino-1-(5-chloro-3-pyridinyl)propan-2-ol (PubChem CID 55270497) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is (1R,2R)-1-amino-1-(5-chloro-3-pyridinyl)propan-2-ol.
| Compound Name | (1R,2R)-1-amino-1-(5-chloro-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 55270497 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | (1R,2R)-1-amino-1-(5-chloro-3-pyridinyl)propan-2-ol |
| SMILES | C[C@@H](O)[C@H](N)c1cncc(Cl)c1 |
| InChI | InChI=1S/C8H11ClN2O/c1-5(12)8(10)6-2-7(9)4-11-3-6/h2-5,8,12H,10H2,1H3/t5-,8+/m1/s1 |
| InChIKey | XUDOSKBKFYYAFZ-XRGYYRRGSA-N |
| XLogP | 1.12 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |