C11H15ClN2O4 — CID 171897024
ethyl 4-(5-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171897024) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is ethyl 4-(5-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(5-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897024 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | ethyl 4-(5-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnc(Cl)c(N)c1 |
| InChI | InChI=1S/C11H15ClN2O4/c1-2-18-9(16)4-8(15)10(17)6-3-7(13)11(12)14-5-6/h3,5,8,10,15,17H,2,4,13H2,1H3 |
| InChIKey | MDDLPIOPVHFAGO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|