C13H17NO5 — CID 171897496
ethyl 4-(5-acetyl-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171897496) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 4-(5-acetyl-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(5-acetyl-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897496 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 4-(5-acetyl-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cncc(C(C)=O)c1 |
| InChI | InChI=1S/C13H17NO5/c1-3-19-12(17)5-11(16)13(18)10-4-9(8(2)15)6-14-7-10/h4,6-7,11,13,16,18H,3,5H2,1-2H3 |
| InChIKey | MAPKFQRIDIRTGX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |