C9H13NO5 — CID 171896770
ethyl 3,4-dihydroxy-4-(1,2-oxazol-4-yl)butanoate (PubChem CID 171896770) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(1,2-oxazol-4-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(1,2-oxazol-4-yl)butanoate |
|---|---|
| PubChem CID | 171896770 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(1,2-oxazol-4-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnoc1 |
| InChI | InChI=1S/C9H13NO5/c1-2-14-8(12)3-7(11)9(13)6-4-10-15-5-6/h4-5,7,9,11,13H,2-3H2,1H3 |
| InChIKey | WYUNIGSZVYVNEO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |