C10H16N4O4 — CID 171897017
ethyl 4-(5,6-diaminopyrazin-2-yl)-3,4-dihydroxybutanoate (PubChem CID 171897017) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is ethyl 4-(5,6-diaminopyrazin-2-yl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(5,6-diaminopyrazin-2-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897017 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethyl 4-(5,6-diaminopyrazin-2-yl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnc(N)c(N)n1 |
| InChI | InChI=1S/C10H16N4O4/c1-2-18-7(16)3-6(15)8(17)5-4-13-9(11)10(12)14-5/h4,6,8,15,17H,2-3H2,1H3,(H2,11,13)(H2,12,14) |
| InChIKey | PCTSDQPVBRIUEV-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |