C10H14N2O5 — CID 171896844
ethyl 3,4-dihydroxy-4-(5-hydroxypyrimidin-2-yl)butanoate (PubChem CID 171896844) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(5-hydroxypyrimidin-2-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(5-hydroxypyrimidin-2-yl)butanoate |
|---|---|
| PubChem CID | 171896844 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(5-hydroxypyrimidin-2-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ncc(O)cn1 |
| InChI | InChI=1S/C10H14N2O5/c1-2-17-8(15)3-7(14)9(16)10-11-4-6(13)5-12-10/h4-5,7,9,13-14,16H,2-3H2,1H3 |
| InChIKey | GAVDXMMZSZHNJT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |