C11H13Cl2NO4 — CID 171897131
ethyl 4-(3,5-dichloro-2-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171897131) has the molecular formula C11H13Cl2NO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is ethyl 4-(3,5-dichloro-2-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(3,5-dichloro-2-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897131 |
| Molecular Formula | C11H13Cl2NO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | ethyl 4-(3,5-dichloro-2-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO4/c1-2-18-9(16)4-8(15)11(17)10-7(13)3-6(12)5-14-10/h3,5,8,11,15,17H,2,4H2,1H3 |
| InChIKey | QPTTYFTUCHHOCA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |