C10H11Cl2NO4 — CID 171895342
methyl 4-(2,5-dichloro-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171895342) has the molecular formula C10H11Cl2NO4 and a molecular weight of 280.11 g/mol. Its IUPAC name is methyl 4-(2,5-dichloro-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2,5-dichloro-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895342 |
| Molecular Formula | C10H11Cl2NO4 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | methyl 4-(2,5-dichloro-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc(Cl)cnc1Cl |
| InChI | InChI=1S/C10H11Cl2NO4/c1-17-8(15)3-7(14)9(16)6-2-5(11)4-13-10(6)12/h2,4,7,9,14,16H,3H2,1H3 |
| InChIKey | MLRDXVZOXJWDEB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|