C11H12BrClO4 — CID 171896669
methyl 4-(2-bromo-4-chlorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171896669) has the molecular formula C11H12BrClO4 and a molecular weight of 323.57 g/mol. Its IUPAC name is methyl 4-(2-bromo-4-chlorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2-bromo-4-chlorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896669 |
| Molecular Formula | C11H12BrClO4 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | methyl 4-(2-bromo-4-chlorophenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C11H12BrClO4/c1-17-10(15)5-9(14)11(16)7-3-2-6(13)4-8(7)12/h2-4,9,11,14,16H,5H2,1H3 |
| InChIKey | DMQPGZFSROOXBY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |