C12H13ClN2O4 — CID 171897347
ethyl 4-(6-chloro-5-cyano-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171897347) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is ethyl 4-(6-chloro-5-cyano-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(6-chloro-5-cyano-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897347 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | ethyl 4-(6-chloro-5-cyano-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnc(Cl)c(C#N)c1 |
| InChI | InChI=1S/C12H13ClN2O4/c1-2-19-10(17)4-9(16)11(18)8-3-7(5-14)12(13)15-6-8/h3,6,9,11,16,18H,2,4H2,1H3 |
| InChIKey | PEPVNEHWQIEMCC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|