C10H11ClN2O2S — CID 171874057
2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carbonitrile (PubChem CID 171874057) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is 2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carbonitrile.
| Compound Name | 2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171874057 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C(O)C(O)CCS)cnc1Cl |
| InChI | InChI=1S/C10H11ClN2O2S/c11-10-6(4-12)3-7(5-13-10)9(15)8(14)1-2-16/h3,5,8-9,14-16H,1-2H2 |
| InChIKey | AKCVFXZOZWIKRT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|