C10H14N2O4S — CID 171874465
2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylic acid (PubChem CID 171874465) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylic acid.
| Compound Name | 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 171874465 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylic acid |
| SMILES | Nc1ncc(C(O)C(O)CCS)cc1C(=O)O |
| InChI | InChI=1S/C10H14N2O4S/c11-9-6(10(15)16)3-5(4-12-9)8(14)7(13)1-2-17/h3-4,7-8,13-14,17H,1-2H2,(H2,11,12)(H,15,16) |
| InChIKey | NXINUOKUIMNYMR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|