C11H16N2O4S — CID 171874724
methyl 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylate (PubChem CID 171874724) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 171874724 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 2-amino-5-(1,2-dihydroxy-4-sulfanylbutyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCS)cnc1N |
| InChI | InChI=1S/C11H16N2O4S/c1-17-11(16)7-4-6(5-13-10(7)12)9(15)8(14)2-3-18/h4-5,8-9,14-15,18H,2-3H2,1H3,(H2,12,13) |
| InChIKey | HDYWURBJJFVGRB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|