C7H9N3O2 — CID 83792494
methyl 2,5-diaminopyridine-3-carboxylate (PubChem CID 83792494) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is methyl 2,5-diaminopyridine-3-carboxylate.
| Compound Name | methyl 2,5-diaminopyridine-3-carboxylate |
|---|---|
| PubChem CID | 83792494 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | methyl 2,5-diaminopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(N)cnc1N |
| InChI | InChI=1S/C7H9N3O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,8H2,1H3,(H2,9,10) |
| InChIKey | PTBHADOYGZEBKU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |