methyl 2,5-diaminopyridine-3-carboxylate

C7H9N3O2 — CID 83792494

IUPACmethyl 2,5-diaminopyridine-3-carboxylate
SMILESCOC(=O)c1cc(N)cnc1N
InChIInChI=1S/C7H9N3O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,8H2,1H3,(H2,9,10)
InChIKeyPTBHADOYGZEBKU-UHFFFAOYSA-N
MW167.17 g/mol
LogP0.03
Rot. Bonds1

About methyl 2,5-diaminopyridine-3-carboxylate

methyl 2,5-diaminopyridine-3-carboxylate (PubChem CID 83792494) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is methyl 2,5-diaminopyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 2,5-diaminopyridine-3-carboxylate
PubChem CID83792494
Molecular FormulaC7H9N3O2
Molecular Weight167.17 g/mol
Exact Mass167.07
IUPAC Namemethyl 2,5-diaminopyridine-3-carboxylate
SMILESCOC(=O)c1cc(N)cnc1N
InChIInChI=1S/C7H9N3O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,8H2,1H3,(H2,9,10)
InChIKeyPTBHADOYGZEBKU-UHFFFAOYSA-N
XLogP0.03
TPSA91.23 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.17
LogP ≤ 50.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 2,5-diaminopyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,5-diaminopyridine-3-carboxylate?
The IUPAC name of methyl 2,5-diaminopyridine-3-carboxylate (CID 83792494) is methyl 2,5-diaminopyridine-3-carboxylate.
What is the SMILES notation for methyl 2,5-diaminopyridine-3-carboxylate?
The canonical SMILES for methyl 2,5-diaminopyridine-3-carboxylate is COC(=O)c1cc(N)cnc1N.
What is the InChIKey of methyl 2,5-diaminopyridine-3-carboxylate?
The InChIKey is PTBHADOYGZEBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,8H2,1H3,(H2,9,10).
What are the key properties of methyl 2,5-diaminopyridine-3-carboxylate?
methyl 2,5-diaminopyridine-3-carboxylate has a molecular weight of 167.17 g/mol, XLogP of 0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-diaminopyridine-3-carboxylate is sourced from PubChem (CID 83792494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).