C10H13F3N2O2 — CID 156850074
ethane;methyl 2-amino-5-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 156850074) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is ethane;methyl 2-amino-5-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethane;methyl 2-amino-5-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 156850074 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | ethane;methyl 2-amino-5-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CC.COC(=O)c1cc(C(F)(F)F)cnc1N |
| InChI | InChI=1S/C8H7F3N2O2.C2H6/c1-15-7(14)5-2-4(8(9,10)11)3-13-6(5)12;1-2/h2-3H,1H3,(H2,12,13);1-2H3 |
| InChIKey | BERSELBZNGUEOL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |