C10H11BrFNO4 — CID 171860646
methyl 5-(3-bromo-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate (PubChem CID 171860646) has the molecular formula C10H11BrFNO4 and a molecular weight of 308.10 g/mol. Its IUPAC name is methyl 5-(3-bromo-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate.
| Compound Name | methyl 5-(3-bromo-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 171860646 |
| Molecular Formula | C10H11BrFNO4 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | methyl 5-(3-bromo-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(O)C(O)CBr)cnc1F |
| InChI | InChI=1S/C10H11BrFNO4/c1-17-10(16)6-2-5(4-13-9(6)12)8(15)7(14)3-11/h2,4,7-8,14-15H,3H2,1H3 |
| InChIKey | RRGWULGYULDLMB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|