C12H15Cl2NO4 — CID 171897457
ethyl 4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171897457) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is ethyl 4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897457 |
| Molecular Formula | C12H15Cl2NO4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | ethyl 4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(Cl)c(N)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO4/c1-2-19-11(17)5-10(16)12(18)6-3-8(14)9(15)4-7(6)13/h3-4,10,12,16,18H,2,5,15H2,1H3 |
| InChIKey | HJXNXRIQEWJRFK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|