C13H18ClNO5 — CID 171897865
ethyl 4-(4-amino-2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoate (PubChem CID 171897865) has the molecular formula C13H18ClNO5 and a molecular weight of 303.74 g/mol. Its IUPAC name is ethyl 4-(4-amino-2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(4-amino-2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897865 |
| Molecular Formula | C13H18ClNO5 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 4-(4-amino-2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(OC)c(N)cc1Cl |
| InChI | InChI=1S/C13H18ClNO5/c1-3-20-12(17)6-10(16)13(18)7-4-11(19-2)9(15)5-8(7)14/h4-5,10,13,16,18H,3,6,15H2,1-2H3 |
| InChIKey | REWUEGIXBHCXJC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|