C13H16F2O5 — CID 171897738
ethyl 4-(2,3-difluoro-4-methoxyphenyl)-3,4-dihydroxybutanoate (PubChem CID 171897738) has the molecular formula C13H16F2O5 and a molecular weight of 290.26 g/mol. Its IUPAC name is ethyl 4-(2,3-difluoro-4-methoxyphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(2,3-difluoro-4-methoxyphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897738 |
| Molecular Formula | C13H16F2O5 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | ethyl 4-(2,3-difluoro-4-methoxyphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(OC)c(F)c1F |
| InChI | InChI=1S/C13H16F2O5/c1-3-20-10(17)6-8(16)13(18)7-4-5-9(19-2)12(15)11(7)14/h4-5,8,13,16,18H,3,6H2,1-2H3 |
| InChIKey | MMWCZNCQFJERMI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |