C10H15N3O5 — CID 171866243
ethyl 3-(5-amino-6-methoxypyrazin-2-yl)-2,3-dihydroxypropanoate (PubChem CID 171866243) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is ethyl 3-(5-amino-6-methoxypyrazin-2-yl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(5-amino-6-methoxypyrazin-2-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866243 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | ethyl 3-(5-amino-6-methoxypyrazin-2-yl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cnc(N)c(OC)n1 |
| InChI | InChI=1S/C10H15N3O5/c1-3-18-10(16)7(15)6(14)5-4-12-8(11)9(13-5)17-2/h4,6-7,14-15H,3H2,1-2H3,(H2,11,12) |
| InChIKey | FTDUYVQEXADZHK-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |