C10H12ClNO4 — CID 171865586
ethyl 3-(5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate (PubChem CID 171865586) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is ethyl 3-(5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865586 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | ethyl 3-(5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H12ClNO4/c1-2-16-10(15)9(14)8(13)7-4-3-6(11)5-12-7/h3-5,8-9,13-14H,2H2,1H3 |
| InChIKey | XXKUCGINQQCQHJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |