C9H12N2O4 — CID 171863534
methyl 3-(5-amino-2-pyridinyl)-2,3-dihydroxypropanoate (PubChem CID 171863534) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is methyl 3-(5-amino-2-pyridinyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(5-amino-2-pyridinyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171863534 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | methyl 3-(5-amino-2-pyridinyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(N)cn1 |
| InChI | InChI=1S/C9H12N2O4/c1-15-9(14)8(13)7(12)6-3-2-5(10)4-11-6/h2-4,7-8,12-13H,10H2,1H3 |
| InChIKey | UIKWWUVRUUMASD-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |