C10H14N2O4 — CID 171895049
methyl 4-(5-amino-2-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171895049) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 4-(5-amino-2-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(5-amino-2-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895049 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl 4-(5-amino-2-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(N)cn1 |
| InChI | InChI=1S/C10H14N2O4/c1-16-9(14)4-8(13)10(15)7-3-2-6(11)5-12-7/h2-3,5,8,10,13,15H,4,11H2,1H3 |
| InChIKey | CDRPRYPOMBVXJQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |