C10H16N2O4 — CID 171896783
ethyl 3,4-dihydroxy-4-(1-methylpyrazol-4-yl)butanoate (PubChem CID 171896783) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(1-methylpyrazol-4-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(1-methylpyrazol-4-yl)butanoate |
|---|---|
| PubChem CID | 171896783 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(1-methylpyrazol-4-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnn(C)c1 |
| InChI | InChI=1S/C10H16N2O4/c1-3-16-9(14)4-8(13)10(15)7-5-11-12(2)6-7/h5-6,8,10,13,15H,3-4H2,1-2H3 |
| InChIKey | IXOQCRCYRJVSLE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |