C8H15N3O2 — CID 171880658
4-amino-1-(1-methylpyrazol-4-yl)butane-1,2-diol (PubChem CID 171880658) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-amino-1-(1-methylpyrazol-4-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(1-methylpyrazol-4-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880658 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-amino-1-(1-methylpyrazol-4-yl)butane-1,2-diol |
| SMILES | Cn1cc(C(O)C(O)CCN)cn1 |
| InChI | InChI=1S/C8H15N3O2/c1-11-5-6(4-10-11)8(13)7(12)2-3-9/h4-5,7-8,12-13H,2-3,9H2,1H3 |
| InChIKey | VSYJWIVAXOZSKQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |