C9H16N2O2 — CID 103454881
1-(1-methylpyrazol-4-yl)pentane-1,2-diol (PubChem CID 103454881) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)pentane-1,2-diol.
| Compound Name | 1-(1-methylpyrazol-4-yl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103454881 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)c1cnn(C)c1 |
| InChI | InChI=1S/C9H16N2O2/c1-3-4-8(12)9(13)7-5-10-11(2)6-7/h5-6,8-9,12-13H,3-4H2,1-2H3 |
| InChIKey | JTRKIJHHQVLMIQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |