C9H11N3 — CID 74891559
(1R)-1-(5-ethynyl-3-pyridinyl)ethane-1,2-diamine (PubChem CID 74891559) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is (1R)-1-(5-ethynyl-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(5-ethynyl-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 74891559 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (1R)-1-(5-ethynyl-3-pyridinyl)ethane-1,2-diamine |
| SMILES | C#Cc1cncc([C@@H](N)CN)c1 |
| InChI | InChI=1S/C9H11N3/c1-2-7-3-8(6-12-5-7)9(11)4-10/h1,3,5-6,9H,4,10-11H2/t9-/m0/s1 |
| InChIKey | DWCPJRVWAHNEAT-VIFPVBQESA-N |
| XLogP | 0.02 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|