C33H15N3 — CID 143762177
3-[2-[3,5-bis[2-(5-ethynyl-3-pyridinyl)ethynyl]phenyl]ethynyl]-5-ethynylpyridine (PubChem CID 143762177) has the molecular formula C33H15N3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 3-[2-[3,5-bis[2-(5-ethynyl-3-pyridinyl)ethynyl]phenyl]ethynyl]-5-ethynylpyridine.
| Compound Name | 3-[2-[3,5-bis[2-(5-ethynyl-3-pyridinyl)ethynyl]phenyl]ethynyl]-5-ethynylpyridine |
|---|---|
| PubChem CID | 143762177 |
| Molecular Formula | C33H15N3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 3-[2-[3,5-bis[2-(5-ethynyl-3-pyridinyl)ethynyl]phenyl]ethynyl]-5-ethynylpyridine |
| SMILES | C#Cc1cncc(C#Cc2cc(C#Cc3cncc(C#C)c3)cc(C#Cc3cncc(C#C)c3)c2)c1 |
| InChI | InChI=1S/C33H15N3/c1-4-25-13-31(22-34-19-25)10-7-28-16-29(8-11-32-14-26(5-2)20-35-23-32)18-30(17-28)9-12-33-15-27(6-3)21-36-24-33/h1-3,13-24H |
| InChIKey | HMWKXMKQVDIAEA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|