C25H13N — CID 15911031
3,5-bis[2-(3-ethynylphenyl)ethynyl]pyridine (PubChem CID 15911031) has the molecular formula C25H13N and a molecular weight of 327.39 g/mol. Its IUPAC name is 3,5-bis[2-(3-ethynylphenyl)ethynyl]pyridine.
| Compound Name | 3,5-bis[2-(3-ethynylphenyl)ethynyl]pyridine |
|---|---|
| PubChem CID | 15911031 |
| Molecular Formula | C25H13N |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3,5-bis[2-(3-ethynylphenyl)ethynyl]pyridine |
| SMILES | C#Cc1cccc(C#Cc2cncc(C#Cc3cccc(C#C)c3)c2)c1 |
| InChI | InChI=1S/C25H13N/c1-3-20-7-5-9-22(15-20)11-13-24-17-25(19-26-18-24)14-12-23-10-6-8-21(4-2)16-23/h1-2,5-10,15-19H |
| InChIKey | FVQIVEKZMYPHOO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|