C10H10N2O — CID 130118726
5-ethynyl-N,N-dimethylpyridine-3-carboxamide (PubChem CID 130118726) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-ethynyl-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 5-ethynyl-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 130118726 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5-ethynyl-N,N-dimethylpyridine-3-carboxamide |
| SMILES | C#Cc1cncc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C10H10N2O/c1-4-8-5-9(7-11-6-8)10(13)12(2)3/h1,5-7H,2-3H3 |
| InChIKey | VCUPUAPKVAZBOF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|