C15H15N3O2 — CID 162530174
N-(5-tert-butyl-1,2-oxazol-3-yl)-5-ethynylpyridine-3-carboxamide (PubChem CID 162530174) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-5-ethynylpyridine-3-carboxamide.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-5-ethynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 162530174 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-5-ethynylpyridine-3-carboxamide |
| SMILES | C#Cc1cncc(C(=O)Nc2cc(C(C)(C)C)on2)c1 |
| InChI | InChI=1S/C15H15N3O2/c1-5-10-6-11(9-16-8-10)14(19)17-13-7-12(20-18-13)15(2,3)4/h1,6-9H,2-4H3,(H,17,18,19) |
| InChIKey | PEKKKNSUBTVFDT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|