C23H30BrN7O2 — CID 143962309
5-[amino-[(Z)-2-amino-2-(5-bromo-3-pyridinyl)ethenyl]amino]-N-(5-tert-butyl-1,2-oxazol-3-yl)-6-methylpyridine-3-carboxamide;ethane (PubChem CID 143962309) has the molecular formula C23H30BrN7O2 and a molecular weight of 516.44 g/mol. Its IUPAC name is 5-[amino-[(Z)-2-amino-2-(5-bromo-3-pyridinyl)ethenyl]amino]-N-(5-tert-butyl-1,2-oxazol-3-yl)-6-methylpyridine-3-carboxamide;ethane.
| Compound Name | 5-[amino-[(Z)-2-amino-2-(5-bromo-3-pyridinyl)ethenyl]amino]-N-(5-tert-butyl-1,2-oxazol-3-yl)-6-methylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143962309 |
| Molecular Formula | C23H30BrN7O2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 5-[amino-[(Z)-2-amino-2-(5-bromo-3-pyridinyl)ethenyl]amino]-N-(5-tert-butyl-1,2-oxazol-3-yl)-6-methylpyridine-3-carboxamide;ethane |
| SMILES | CC.Cc1ncc(C(=O)Nc2cc(C(C)(C)C)on2)cc1N(N)/C=C(\N)c1cncc(Br)c1 |
| InChI | InChI=1S/C21H24BrN7O2.C2H6/c1-12-17(29(24)11-16(23)13-5-15(22)10-25-8-13)6-14(9-26-12)20(30)27-19-7-18(31-28-19)21(2,3)4;1-2/h5-11H,23-24H2,1-4H3,(H,27,28,30);1-2H3/b16-11-; |
| InChIKey | BWGQISMBVKOMJD-MWVRIADDSA-N |
| XLogP | 4.75 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|