C12H10N4OS — CID 100657762
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-ethynylpyridine-3-carboxamide (PubChem CID 100657762) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-ethynylpyridine-3-carboxamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-ethynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 100657762 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-ethynylpyridine-3-carboxamide |
| SMILES | C#Cc1cncc(C(=O)Nc2nnc(CC)s2)c1 |
| InChI | InChI=1S/C12H10N4OS/c1-3-8-5-9(7-13-6-8)11(17)14-12-16-15-10(4-2)18-12/h1,5-7H,4H2,2H3,(H,14,16,17) |
| InChIKey | LXYSIHGEBHCSHB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|