C13H16ClN5OS — CID 107643171
2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-(propylamino)pyridine-4-carboxamide (PubChem CID 107643171) has the molecular formula C13H16ClN5OS and a molecular weight of 325.83 g/mol. Its IUPAC name is 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-(propylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107643171 |
| Molecular Formula | C13H16ClN5OS |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)Nc2nnc(CC)s2)cc(Cl)n1 |
| InChI | InChI=1S/C13H16ClN5OS/c1-3-5-15-10-7-8(6-9(14)16-10)12(20)17-13-19-18-11(4-2)21-13/h6-7H,3-5H2,1-2H3,(H,15,16)(H,17,19,20) |
| InChIKey | NFYJCBHWTIYAKV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|