C14H14Cl2N4O — CID 103094848
2-chloro-N-(3-chloro-2-pyridinyl)-6-(propylamino)pyridine-4-carboxamide (PubChem CID 103094848) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-2-pyridinyl)-6-(propylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(3-chloro-2-pyridinyl)-6-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103094848 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-chloro-N-(3-chloro-2-pyridinyl)-6-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)Nc2ncccc2Cl)cc(Cl)n1 |
| InChI | InChI=1S/C14H14Cl2N4O/c1-2-5-17-12-8-9(7-11(16)19-12)14(21)20-13-10(15)4-3-6-18-13/h3-4,6-8H,2,5H2,1H3,(H,17,19)(H,18,20,21) |
| InChIKey | IUSHSMRMFXEUKD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|